C12H12FN3OS — CID 8669178
1-(4-fluoroanilino)-3-(furan-2-ylmethyl)thiourea (PubChem CID 8669178) has the molecular formula C12H12FN3OS and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-(4-fluoroanilino)-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-(4-fluoroanilino)-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8669178 |
| Molecular Formula | C12H12FN3OS |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 1-(4-fluoroanilino)-3-(furan-2-ylmethyl)thiourea |
| SMILES | Fc1ccc(NNC(=S)NCc2ccco2)cc1 |
| InChI | InChI=1S/C12H12FN3OS/c13-9-3-5-10(6-4-9)15-16-12(18)14-8-11-2-1-7-17-11/h1-7,15H,8H2,(H2,14,16,18) |
| InChIKey | NMWDFFQNIRVGFZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|