C14H15FN2OS — CID 7944842
1-[(1S)-1-(4-fluorophenyl)ethyl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 7944842) has the molecular formula C14H15FN2OS and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-[(1S)-1-(4-fluorophenyl)ethyl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[(1S)-1-(4-fluorophenyl)ethyl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 7944842 |
| Molecular Formula | C14H15FN2OS |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-[(1S)-1-(4-fluorophenyl)ethyl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | C[C@H](NC(=S)NCc1ccco1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FN2OS/c1-10(11-4-6-12(15)7-5-11)17-14(19)16-9-13-3-2-8-18-13/h2-8,10H,9H2,1H3,(H2,16,17,19)/t10-/m0/s1 |
| InChIKey | JTEBXAROZHVMCV-JTQLQIEISA-N |
| XLogP | 3.14 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|