C12H20N2OS — CID 17277646
1-(3,3-dimethylbutan-2-yl)-3-(furan-2-ylmethyl)thiourea (PubChem CID 17277646) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 1-(3,3-dimethylbutan-2-yl)-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-(3,3-dimethylbutan-2-yl)-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17277646 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(3,3-dimethylbutan-2-yl)-3-(furan-2-ylmethyl)thiourea |
| SMILES | CC(NC(=S)NCc1ccco1)C(C)(C)C |
| InChI | InChI=1S/C12H20N2OS/c1-9(12(2,3)4)14-11(16)13-8-10-6-5-7-15-10/h5-7,9H,8H2,1-4H3,(H2,13,14,16) |
| InChIKey | YUGSJSWVRAQQTG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|