C12H20N2OS — CID 19653033
3-(furan-2-ylmethyl)-1,1-dipropylthiourea (PubChem CID 19653033) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-1,1-dipropylthiourea.
| Compound Name | 3-(furan-2-ylmethyl)-1,1-dipropylthiourea |
|---|---|
| PubChem CID | 19653033 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-(furan-2-ylmethyl)-1,1-dipropylthiourea |
| SMILES | CCCN(CCC)C(=S)NCc1ccco1 |
| InChI | InChI=1S/C12H20N2OS/c1-3-7-14(8-4-2)12(16)13-10-11-6-5-9-15-11/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,13,16) |
| InChIKey | AHBNRLAHUJAUNM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|