C12H19NO2 — CID 110690666
2-(furan-2-yl)-N,N-dipropylacetamide (PubChem CID 110690666) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(furan-2-yl)-N,N-dipropylacetamide.
| Compound Name | 2-(furan-2-yl)-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 110690666 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-(furan-2-yl)-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)Cc1ccco1 |
| InChI | InChI=1S/C12H19NO2/c1-3-7-13(8-4-2)12(14)10-11-6-5-9-15-11/h5-6,9H,3-4,7-8,10H2,1-2H3 |
| InChIKey | OTHFFAVDSSXPRE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |