C8H11NO2 — CID 110484557
N-ethyl-2-(furan-2-yl)acetamide (PubChem CID 110484557) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is N-ethyl-2-(furan-2-yl)acetamide.
| Compound Name | N-ethyl-2-(furan-2-yl)acetamide |
|---|---|
| PubChem CID | 110484557 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | N-ethyl-2-(furan-2-yl)acetamide |
| SMILES | CCNC(=O)Cc1ccco1 |
| InChI | InChI=1S/C8H11NO2/c1-2-9-8(10)6-7-4-3-5-11-7/h3-5H,2,6H2,1H3,(H,9,10) |
| InChIKey | SRDWAMZXRNEPME-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |