C14H15N3O3S — CID 4028444
1-(furan-2-ylmethyl)-3-[(2-phenoxyacetyl)amino]thiourea (PubChem CID 4028444) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[(2-phenoxyacetyl)amino]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[(2-phenoxyacetyl)amino]thiourea |
|---|---|
| PubChem CID | 4028444 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[(2-phenoxyacetyl)amino]thiourea |
| SMILES | O=C(COc1ccccc1)NNC(=S)NCc1ccco1 |
| InChI | InChI=1S/C14H15N3O3S/c18-13(10-20-11-5-2-1-3-6-11)16-17-14(21)15-9-12-7-4-8-19-12/h1-8H,9-10H2,(H,16,18)(H2,15,17,21) |
| InChIKey | NTAPKRKRIOVIFS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|