C18H20N4O3S — CID 7977720
N-[2-[2-(benzylcarbamothioyl)hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide (PubChem CID 7977720) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[2-[2-(benzylcarbamothioyl)hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide.
| Compound Name | N-[2-[2-(benzylcarbamothioyl)hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 7977720 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[2-[2-(benzylcarbamothioyl)hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NCC(=O)NNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C18H20N4O3S/c23-16(12-19-17(24)13-25-15-9-5-2-6-10-15)21-22-18(26)20-11-14-7-3-1-4-8-14/h1-10H,11-13H2,(H,19,24)(H,21,23)(H2,20,22,26) |
| InChIKey | BVWMRFAUZWTHEQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|