C17H22N4O2S — CID 8654191
1-(furan-2-ylmethyl)-3-[[2-(2,4,6-trimethylanilino)acetyl]amino]thiourea (PubChem CID 8654191) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[[2-(2,4,6-trimethylanilino)acetyl]amino]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[[2-(2,4,6-trimethylanilino)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8654191 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[[2-(2,4,6-trimethylanilino)acetyl]amino]thiourea |
| SMILES | Cc1cc(C)c(NCC(=O)NNC(=S)NCc2ccco2)c(C)c1 |
| InChI | InChI=1S/C17H22N4O2S/c1-11-7-12(2)16(13(3)8-11)18-10-15(22)20-21-17(24)19-9-14-5-4-6-23-14/h4-8,18H,9-10H2,1-3H3,(H,20,22)(H2,19,21,24) |
| InChIKey | ZMVAPMMKFOMCQN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|