C18H20O4 — CID 53386901
(6aS,10aS)-6a-acetyl-2-methoxy-8,9-dimethyl-10,10a-dihydro-7H-benzo[c]chromen-6-one (PubChem CID 53386901) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (6aS,10aS)-6a-acetyl-2-methoxy-8,9-dimethyl-10,10a-dihydro-7H-benzo[c]chromen-6-one.
| Compound Name | (6aS,10aS)-6a-acetyl-2-methoxy-8,9-dimethyl-10,10a-dihydro-7H-benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 53386901 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (6aS,10aS)-6a-acetyl-2-methoxy-8,9-dimethyl-10,10a-dihydro-7H-benzo[c]chromen-6-one |
| SMILES | COc1ccc2c(c1)[C@@H]1CC(C)=C(C)C[C@]1(C(C)=O)C(=O)O2 |
| InChI | InChI=1S/C18H20O4/c1-10-7-15-14-8-13(21-4)5-6-16(14)22-17(20)18(15,12(3)19)9-11(10)2/h5-6,8,15H,7,9H2,1-4H3/t15-,18+/m0/s1 |
| InChIKey | ATTGIWCQUMFTIB-MAUKXSAKSA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|