C24H21BrO4 — CID 146035839
9a-(2-bromo-5-methoxybenzoyl)-2,3-dimethyl-4,4a-dihydro-1H-anthracene-9,10-dione (PubChem CID 146035839) has the molecular formula C24H21BrO4 and a molecular weight of 453.33 g/mol. Its IUPAC name is 9a-(2-bromo-5-methoxybenzoyl)-2,3-dimethyl-4,4a-dihydro-1H-anthracene-9,10-dione.
| Compound Name | 9a-(2-bromo-5-methoxybenzoyl)-2,3-dimethyl-4,4a-dihydro-1H-anthracene-9,10-dione |
|---|---|
| PubChem CID | 146035839 |
| Molecular Formula | C24H21BrO4 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 9a-(2-bromo-5-methoxybenzoyl)-2,3-dimethyl-4,4a-dihydro-1H-anthracene-9,10-dione |
| SMILES | COc1ccc(Br)c(C(=O)C23CC(C)=C(C)CC2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C24H21BrO4/c1-13-10-19-21(26)16-6-4-5-7-17(16)22(27)24(19,12-14(13)2)23(28)18-11-15(29-3)8-9-20(18)25/h4-9,11,19H,10,12H2,1-3H3 |
| InChIKey | UKTGPOJWCWJQMV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|