C18H20O3 — CID 132529040
(4aS,9aS)-9a-acetyl-6-methoxy-2,3-dimethyl-4,4a-dihydro-1H-fluoren-9-one (PubChem CID 132529040) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is (4aS,9aS)-9a-acetyl-6-methoxy-2,3-dimethyl-4,4a-dihydro-1H-fluoren-9-one.
| Compound Name | (4aS,9aS)-9a-acetyl-6-methoxy-2,3-dimethyl-4,4a-dihydro-1H-fluoren-9-one |
|---|---|
| PubChem CID | 132529040 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (4aS,9aS)-9a-acetyl-6-methoxy-2,3-dimethyl-4,4a-dihydro-1H-fluoren-9-one |
| SMILES | COc1ccc2c(c1)[C@@H]1CC(C)=C(C)C[C@]1(C(C)=O)C2=O |
| InChI | InChI=1S/C18H20O3/c1-10-7-16-15-8-13(21-4)5-6-14(15)17(20)18(16,12(3)19)9-11(10)2/h5-6,8,16H,7,9H2,1-4H3/t16-,18+/m0/s1 |
| InChIKey | YNGRPLLDDCIASN-FUHWJXTLSA-N |
| XLogP | 3.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|