C13H14O3 — CID 129383938
(1aS,7bS)-6-methoxy-2,2-dimethyl-1a,7b-dihydronaphtho[1,2-b]oxiren-3-one (PubChem CID 129383938) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (1aS,7bS)-6-methoxy-2,2-dimethyl-1a,7b-dihydronaphtho[1,2-b]oxiren-3-one.
| Compound Name | (1aS,7bS)-6-methoxy-2,2-dimethyl-1a,7b-dihydronaphtho[1,2-b]oxiren-3-one |
|---|---|
| PubChem CID | 129383938 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1aS,7bS)-6-methoxy-2,2-dimethyl-1a,7b-dihydronaphtho[1,2-b]oxiren-3-one |
| SMILES | COc1ccc2c(c1)[C@@H]1O[C@H]1C(C)(C)C2=O |
| InChI | InChI=1S/C13H14O3/c1-13(2)11(14)8-5-4-7(15-3)6-9(8)10-12(13)16-10/h4-6,10,12H,1-3H3/t10-,12+/m0/s1 |
| InChIKey | FQETZCBEKYQUCZ-CMPLNLGQSA-N |
| XLogP | 2.36 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|