C9H6Br2O3 — CID 5325532
2,2-dibromo-6-methoxy-1-benzofuran-3-one (PubChem CID 5325532) has the molecular formula C9H6Br2O3 and a molecular weight of 321.95 g/mol. Its IUPAC name is 2,2-dibromo-6-methoxy-1-benzofuran-3-one.
| Compound Name | 2,2-dibromo-6-methoxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 5325532 |
| Molecular Formula | C9H6Br2O3 |
| Molecular Weight | 321.95 g/mol |
| Exact Mass | 319.87 |
| IUPAC Name | 2,2-dibromo-6-methoxy-1-benzofuran-3-one |
| SMILES | COc1ccc2c(c1)OC(Br)(Br)C2=O |
| InChI | InChI=1S/C9H6Br2O3/c1-13-5-2-3-6-7(4-5)14-9(10,11)8(6)12/h2-4H,1H3 |
| InChIKey | JSHHLVLHWGYMTC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.95 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|