C13H14O3 — CID 11042200
7-methoxy-2,2-dimethylchromene-4-carbaldehyde (PubChem CID 11042200) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethylchromene-4-carbaldehyde.
| Compound Name | 7-methoxy-2,2-dimethylchromene-4-carbaldehyde |
|---|---|
| PubChem CID | 11042200 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 7-methoxy-2,2-dimethylchromene-4-carbaldehyde |
| SMILES | COc1ccc2c(c1)OC(C)(C)C=C2C=O |
| InChI | InChI=1S/C13H14O3/c1-13(2)7-9(8-14)11-5-4-10(15-3)6-12(11)16-13/h4-8H,1-3H3 |
| InChIKey | QYHPBLVERHPNGE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|