C13H14O4 — CID 4126490
6-methoxy-2,2-dimethyl-4-oxo-3H-chromene-3-carbaldehyde (PubChem CID 4126490) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 6-methoxy-2,2-dimethyl-4-oxo-3H-chromene-3-carbaldehyde.
| Compound Name | 6-methoxy-2,2-dimethyl-4-oxo-3H-chromene-3-carbaldehyde |
|---|---|
| PubChem CID | 4126490 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 6-methoxy-2,2-dimethyl-4-oxo-3H-chromene-3-carbaldehyde |
| SMILES | COc1ccc2c(c1)C(=O)C(C=O)C(C)(C)O2 |
| InChI | InChI=1S/C13H14O4/c1-13(2)10(7-14)12(15)9-6-8(16-3)4-5-11(9)17-13/h4-7,10H,1-3H3 |
| InChIKey | GPHRKCYLXTYLNI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|