C21H22O5 — CID 42611874
(6aR,11aR)-3,8,9-trimethoxy-6,6-dimethyl-6a,11a-dihydroindeno[1,2-c]chromen-11-one (PubChem CID 42611874) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is (6aR,11aR)-3,8,9-trimethoxy-6,6-dimethyl-6a,11a-dihydroindeno[1,2-c]chromen-11-one.
| Compound Name | (6aR,11aR)-3,8,9-trimethoxy-6,6-dimethyl-6a,11a-dihydroindeno[1,2-c]chromen-11-one |
|---|---|
| PubChem CID | 42611874 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (6aR,11aR)-3,8,9-trimethoxy-6,6-dimethyl-6a,11a-dihydroindeno[1,2-c]chromen-11-one |
| SMILES | COc1ccc2c(c1)OC(C)(C)[C@H]1c3cc(OC)c(OC)cc3C(=O)[C@@H]21 |
| InChI | InChI=1S/C21H22O5/c1-21(2)19-13-9-16(24-4)17(25-5)10-14(13)20(22)18(19)12-7-6-11(23-3)8-15(12)26-21/h6-10,18-19H,1-5H3/t18-,19-/m0/s1 |
| InChIKey | FWGCEEWBVLNLFE-OALUTQOASA-N |
| XLogP | 3.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |