C13H17BrO4 — CID 14561850
(3S,4R)-3-bromo-6,7-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol (PubChem CID 14561850) has the molecular formula C13H17BrO4 and a molecular weight of 317.18 g/mol. Its IUPAC name is (3S,4R)-3-bromo-6,7-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol.
| Compound Name | (3S,4R)-3-bromo-6,7-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 14561850 |
| Molecular Formula | C13H17BrO4 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | (3S,4R)-3-bromo-6,7-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| SMILES | COc1cc2c(cc1OC)[C@@H](O)[C@H](Br)C(C)(C)O2 |
| InChI | InChI=1S/C13H17BrO4/c1-13(2)12(14)11(15)7-5-9(16-3)10(17-4)6-8(7)18-13/h5-6,11-12,15H,1-4H3/t11-,12+/m1/s1 |
| InChIKey | MWVOYXZKZURRNC-NEPJUHHUSA-N |
| XLogP | 2.67 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|