C17H18BrNO2 — CID 23371783
3-bromo-2,2-dimethyl-6-(2-methyl-4-pyridinyl)-3,4-dihydrochromen-4-ol (PubChem CID 23371783) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is 3-bromo-2,2-dimethyl-6-(2-methyl-4-pyridinyl)-3,4-dihydrochromen-4-ol.
| Compound Name | 3-bromo-2,2-dimethyl-6-(2-methyl-4-pyridinyl)-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 23371783 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 3-bromo-2,2-dimethyl-6-(2-methyl-4-pyridinyl)-3,4-dihydrochromen-4-ol |
| SMILES | Cc1cc(-c2ccc3c(c2)C(O)C(Br)C(C)(C)O3)ccn1 |
| InChI | InChI=1S/C17H18BrNO2/c1-10-8-12(6-7-19-10)11-4-5-14-13(9-11)15(20)16(18)17(2,3)21-14/h4-9,15-16,20H,1-3H3 |
| InChIKey | CMXZDNJHLOXWAC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|