C18H19BrO5S — CID 67946380
(3S,4R)-3-bromo-6-(2-methoxyphenyl)sulfonyl-2,2-dimethyl-3,4-dihydrochromen-4-ol (PubChem CID 67946380) has the molecular formula C18H19BrO5S and a molecular weight of 427.32 g/mol. Its IUPAC name is (3S,4R)-3-bromo-6-(2-methoxyphenyl)sulfonyl-2,2-dimethyl-3,4-dihydrochromen-4-ol.
| Compound Name | (3S,4R)-3-bromo-6-(2-methoxyphenyl)sulfonyl-2,2-dimethyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 67946380 |
| Molecular Formula | C18H19BrO5S |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | (3S,4R)-3-bromo-6-(2-methoxyphenyl)sulfonyl-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| SMILES | COc1ccccc1S(=O)(=O)c1ccc2c(c1)[C@@H](O)[C@H](Br)C(C)(C)O2 |
| InChI | InChI=1S/C18H19BrO5S/c1-18(2)17(19)16(20)12-10-11(8-9-13(12)24-18)25(21,22)15-7-5-4-6-14(15)23-3/h4-10,16-17,20H,1-3H3/t16-,17+/m1/s1 |
| InChIKey | TYKUVEUBESXSSI-SJORKVTESA-N |
| XLogP | 3.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|