C13H18O4 — CID 14334290
6,7-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol (PubChem CID 14334290) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 6,7-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol.
| Compound Name | 6,7-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 14334290 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 6,7-dimethoxy-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| SMILES | COc1cc2c(cc1OC)C(O)CC(C)(C)O2 |
| InChI | InChI=1S/C13H18O4/c1-13(2)7-9(14)8-5-11(15-3)12(16-4)6-10(8)17-13/h5-6,9,14H,7H2,1-4H3 |
| InChIKey | DLBSZDGCDYZTGP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |