C13H16O4 — CID 70492081
3,7-dimethoxy-2,2-dimethyl-3H-chromen-4-one (PubChem CID 70492081) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 3,7-dimethoxy-2,2-dimethyl-3H-chromen-4-one.
| Compound Name | 3,7-dimethoxy-2,2-dimethyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 70492081 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3,7-dimethoxy-2,2-dimethyl-3H-chromen-4-one |
| SMILES | COc1ccc2c(c1)OC(C)(C)C(OC)C2=O |
| InChI | InChI=1S/C13H16O4/c1-13(2)12(16-4)11(14)9-6-5-8(15-3)7-10(9)17-13/h5-7,12H,1-4H3 |
| InChIKey | YWEHAZRSHNPICY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |