C11H10F2O4 — CID 691652
(2R)-2-(difluoromethyl)-2-hydroxy-7-methoxy-3H-chromen-4-one (PubChem CID 691652) has the molecular formula C11H10F2O4 and a molecular weight of 244.19 g/mol. Its IUPAC name is (2R)-2-(difluoromethyl)-2-hydroxy-7-methoxy-3H-chromen-4-one.
| Compound Name | (2R)-2-(difluoromethyl)-2-hydroxy-7-methoxy-3H-chromen-4-one |
|---|---|
| PubChem CID | 691652 |
| Molecular Formula | C11H10F2O4 |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (2R)-2-(difluoromethyl)-2-hydroxy-7-methoxy-3H-chromen-4-one |
| SMILES | COc1ccc2c(c1)O[C@@](O)(C(F)F)CC2=O |
| InChI | InChI=1S/C11H10F2O4/c1-16-6-2-3-7-8(14)5-11(15,10(12)13)17-9(7)4-6/h2-4,10,15H,5H2,1H3/t11-/m1/s1 |
| InChIKey | IOHMZHGQYXEGIE-LLVKDONJSA-N |
| XLogP | 1.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |