C22H18O4 — CID 150532948
(2S)-2-(4-hydroxyphenyl)-7-methoxy-2-phenyl-3H-chromen-4-one (PubChem CID 150532948) has the molecular formula C22H18O4 and a molecular weight of 346.38 g/mol. Its IUPAC name is (2S)-2-(4-hydroxyphenyl)-7-methoxy-2-phenyl-3H-chromen-4-one.
| Compound Name | (2S)-2-(4-hydroxyphenyl)-7-methoxy-2-phenyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 150532948 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (2S)-2-(4-hydroxyphenyl)-7-methoxy-2-phenyl-3H-chromen-4-one |
| SMILES | COc1ccc2c(c1)O[C@@](c1ccccc1)(c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C22H18O4/c1-25-18-11-12-19-20(24)14-22(26-21(19)13-18,15-5-3-2-4-6-15)16-7-9-17(23)10-8-16/h2-13,23H,14H2,1H3/t22-/m0/s1 |
| InChIKey | IEFPZDCKTVLHNF-QFIPXVFZSA-N |
| XLogP | 4.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |