C12H10F4O4 — CID 744444
(2R)-2-hydroxy-7-methoxy-2-(1,1,2,2-tetrafluoroethyl)-3H-chromen-4-one (PubChem CID 744444) has the molecular formula C12H10F4O4 and a molecular weight of 294.20 g/mol. Its IUPAC name is (2R)-2-hydroxy-7-methoxy-2-(1,1,2,2-tetrafluoroethyl)-3H-chromen-4-one.
| Compound Name | (2R)-2-hydroxy-7-methoxy-2-(1,1,2,2-tetrafluoroethyl)-3H-chromen-4-one |
|---|---|
| PubChem CID | 744444 |
| Molecular Formula | C12H10F4O4 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | (2R)-2-hydroxy-7-methoxy-2-(1,1,2,2-tetrafluoroethyl)-3H-chromen-4-one |
| SMILES | COc1ccc2c(c1)O[C@@](O)(C(F)(F)C(F)F)CC2=O |
| InChI | InChI=1S/C12H10F4O4/c1-19-6-2-3-7-8(17)5-11(18,20-9(7)4-6)12(15,16)10(13)14/h2-4,10,18H,5H2,1H3/t11-/m1/s1 |
| InChIKey | AOLCPXRGICDDCR-LLVKDONJSA-N |
| XLogP | 2.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|