C16H20O4 — CID 106875112
3',7-dimethoxyspiro[3H-chromene-2,1'-cyclohexane]-4-one (PubChem CID 106875112) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 3',7-dimethoxyspiro[3H-chromene-2,1'-cyclohexane]-4-one.
| Compound Name | 3',7-dimethoxyspiro[3H-chromene-2,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 106875112 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3',7-dimethoxyspiro[3H-chromene-2,1'-cyclohexane]-4-one |
| SMILES | COc1ccc2c(c1)OC1(CCCC(OC)C1)CC2=O |
| InChI | InChI=1S/C16H20O4/c1-18-11-5-6-13-14(17)10-16(20-15(13)8-11)7-3-4-12(9-16)19-2/h5-6,8,12H,3-4,7,9-10H2,1-2H3 |
| InChIKey | LPUNROJPQFMRNS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |