C12H10F4O3 — CID 867525
(2S)-2-hydroxy-6-methyl-2-(1,1,2,2-tetrafluoroethyl)-3H-chromen-4-one (PubChem CID 867525) has the molecular formula C12H10F4O3 and a molecular weight of 278.20 g/mol. Its IUPAC name is (2S)-2-hydroxy-6-methyl-2-(1,1,2,2-tetrafluoroethyl)-3H-chromen-4-one.
| Compound Name | (2S)-2-hydroxy-6-methyl-2-(1,1,2,2-tetrafluoroethyl)-3H-chromen-4-one |
|---|---|
| PubChem CID | 867525 |
| Molecular Formula | C12H10F4O3 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (2S)-2-hydroxy-6-methyl-2-(1,1,2,2-tetrafluoroethyl)-3H-chromen-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)C[C@@](O)(C(F)(F)C(F)F)O2 |
| InChI | InChI=1S/C12H10F4O3/c1-6-2-3-9-7(4-6)8(17)5-11(18,19-9)12(15,16)10(13)14/h2-4,10,18H,5H2,1H3/t11-/m0/s1 |
| InChIKey | IXEQTHCVACLUNU-NSHDSACASA-N |
| XLogP | 2.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|