C13H11F5O3 — CID 951344
(2S)-2-hydroxy-5,7-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)-3H-chromen-4-one (PubChem CID 951344) has the molecular formula C13H11F5O3 and a molecular weight of 310.22 g/mol. Its IUPAC name is (2S)-2-hydroxy-5,7-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)-3H-chromen-4-one.
| Compound Name | (2S)-2-hydroxy-5,7-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)-3H-chromen-4-one |
|---|---|
| PubChem CID | 951344 |
| Molecular Formula | C13H11F5O3 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (2S)-2-hydroxy-5,7-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)-3H-chromen-4-one |
| SMILES | Cc1cc(C)c2c(c1)O[C@](O)(C(F)(F)C(F)(F)F)CC2=O |
| InChI | InChI=1S/C13H11F5O3/c1-6-3-7(2)10-8(19)5-11(20,21-9(10)4-6)12(14,15)13(16,17)18/h3-4,20H,5H2,1-2H3/t11-/m0/s1 |
| InChIKey | PCVZMQANBMXMKG-NSHDSACASA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|