C15H18O4 — CID 82019264
3-(2,5,7-trimethyl-4-oxo-3H-chromen-2-yl)propanoic acid (PubChem CID 82019264) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-(2,5,7-trimethyl-4-oxo-3H-chromen-2-yl)propanoic acid.
| Compound Name | 3-(2,5,7-trimethyl-4-oxo-3H-chromen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 82019264 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-(2,5,7-trimethyl-4-oxo-3H-chromen-2-yl)propanoic acid |
| SMILES | Cc1cc(C)c2c(c1)OC(C)(CCC(=O)O)CC2=O |
| InChI | InChI=1S/C15H18O4/c1-9-6-10(2)14-11(16)8-15(3,5-4-13(17)18)19-12(14)7-9/h6-7H,4-5,8H2,1-3H3,(H,17,18) |
| InChIKey | BCNIWRNNQWNJGF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |