C20H21N5O2 — CID 108776361
5,7-dimethyl-1'-(7H-purin-6-yl)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108776361) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 5,7-dimethyl-1'-(7H-purin-6-yl)spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 5,7-dimethyl-1'-(7H-purin-6-yl)spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108776361 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 5,7-dimethyl-1'-(7H-purin-6-yl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc(C)c2c(c1)OC1(CCN(c3ncnc4nc[nH]c34)CC1)CC2=O |
| InChI | InChI=1S/C20H21N5O2/c1-12-7-13(2)16-14(26)9-20(27-15(16)8-12)3-5-25(6-4-20)19-17-18(22-10-21-17)23-11-24-19/h7-8,10-11H,3-6,9H2,1-2H3,(H,21,22,23,24) |
| InChIKey | QNLOILKBUCMLRY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |