C19H19ClN4O4 — CID 108774534
1'-(6-chloro-5-nitropyrimidin-4-yl)-6,8-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108774534) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is 1'-(6-chloro-5-nitropyrimidin-4-yl)-6,8-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-(6-chloro-5-nitropyrimidin-4-yl)-6,8-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108774534 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 1'-(6-chloro-5-nitropyrimidin-4-yl)-6,8-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc(C)c2c(c1)C(=O)CC1(CCN(c3ncnc(Cl)c3[N+](=O)[O-])CC1)O2 |
| InChI | InChI=1S/C19H19ClN4O4/c1-11-7-12(2)16-13(8-11)14(25)9-19(28-16)3-5-23(6-4-19)18-15(24(26)27)17(20)21-10-22-18/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | FDHNLXDVUAGZRG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|