C17H15ClN4O5 — CID 108778720
1'-(6-chloro-5-nitropyrimidin-4-yl)-6-methoxyspiro[3H-chromene-2,3'-pyrrolidine]-4-one (PubChem CID 108778720) has the molecular formula C17H15ClN4O5 and a molecular weight of 390.78 g/mol. Its IUPAC name is 1'-(6-chloro-5-nitropyrimidin-4-yl)-6-methoxyspiro[3H-chromene-2,3'-pyrrolidine]-4-one.
| Compound Name | 1'-(6-chloro-5-nitropyrimidin-4-yl)-6-methoxyspiro[3H-chromene-2,3'-pyrrolidine]-4-one |
|---|---|
| PubChem CID | 108778720 |
| Molecular Formula | C17H15ClN4O5 |
| Molecular Weight | 390.78 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 1'-(6-chloro-5-nitropyrimidin-4-yl)-6-methoxyspiro[3H-chromene-2,3'-pyrrolidine]-4-one |
| SMILES | COc1ccc2c(c1)C(=O)CC1(CCN(c3ncnc(Cl)c3[N+](=O)[O-])C1)O2 |
| InChI | InChI=1S/C17H15ClN4O5/c1-26-10-2-3-13-11(6-10)12(23)7-17(27-13)4-5-21(8-17)16-14(22(24)25)15(18)19-9-20-16/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | HKHMZUHGFPWHAP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 107.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.78 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|