C16H20O2 — CID 114673541
2-(cyclobutylmethyl)-2,6-dimethyl-3H-chromen-4-one (PubChem CID 114673541) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-2,6-dimethyl-3H-chromen-4-one.
| Compound Name | 2-(cyclobutylmethyl)-2,6-dimethyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 114673541 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2-(cyclobutylmethyl)-2,6-dimethyl-3H-chromen-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)CC(C)(CC1CCC1)O2 |
| InChI | InChI=1S/C16H20O2/c1-11-6-7-15-13(8-11)14(17)10-16(2,18-15)9-12-4-3-5-12/h6-8,12H,3-5,9-10H2,1-2H3 |
| InChIKey | CVUNCMRDNBFJMY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |