C24H24O3 — CID 57012204
4-(7-methoxy-2,2-dimethyl-3-phenyl-4H-chromen-3-yl)phenol (PubChem CID 57012204) has the molecular formula C24H24O3 and a molecular weight of 360.45 g/mol. Its IUPAC name is 4-(7-methoxy-2,2-dimethyl-3-phenyl-4H-chromen-3-yl)phenol.
| Compound Name | 4-(7-methoxy-2,2-dimethyl-3-phenyl-4H-chromen-3-yl)phenol |
|---|---|
| PubChem CID | 57012204 |
| Molecular Formula | C24H24O3 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-(7-methoxy-2,2-dimethyl-3-phenyl-4H-chromen-3-yl)phenol |
| SMILES | COc1ccc2c(c1)OC(C)(C)C(c1ccccc1)(c1ccc(O)cc1)C2 |
| InChI | InChI=1S/C24H24O3/c1-23(2)24(18-7-5-4-6-8-18,19-10-12-20(25)13-11-19)16-17-9-14-21(26-3)15-22(17)27-23/h4-15,25H,16H2,1-3H3 |
| InChIKey | CARMVQKFLOYOTE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |