C17H14O4 — CID 1276783
(1aR,7aS)-4-methoxy-1a-methyl-7a-phenyloxireno[2,3-b]chromen-7-one (PubChem CID 1276783) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is (1aR,7aS)-4-methoxy-1a-methyl-7a-phenyloxireno[2,3-b]chromen-7-one.
| Compound Name | (1aR,7aS)-4-methoxy-1a-methyl-7a-phenyloxireno[2,3-b]chromen-7-one |
|---|---|
| PubChem CID | 1276783 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (1aR,7aS)-4-methoxy-1a-methyl-7a-phenyloxireno[2,3-b]chromen-7-one |
| SMILES | COc1ccc2c(c1)O[C@]1(C)O[C@@]1(c1ccccc1)C2=O |
| InChI | InChI=1S/C17H14O4/c1-16-17(21-16,11-6-4-3-5-7-11)15(18)13-9-8-12(19-2)10-14(13)20-16/h3-10H,1-2H3/t16-,17+/m1/s1 |
| InChIKey | VMRJIOUWFBJQSV-SJORKVTESA-N |
| XLogP | 2.91 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|