About 4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one
4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one (PubChem CID 91064588) has the molecular formula C8H6O3
and a molecular weight of 150.13 g/mol. Its IUPAC name is 4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one.
Analyze 4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one?
The IUPAC name of 4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one (CID 91064588) is 4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one.
What is the SMILES notation for 4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one?
The canonical SMILES for 4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one is COc1ccc2c(c1)OC2=O.
What is the InChIKey of 4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one?
The InChIKey is SUUUBPLHZDUWQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O3/c1-10-5-2-3-6-7(4-5)11-8(6)9/h2-4H,1H3.
What are the key properties of 4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one?
4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one has a molecular weight of 150.13 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-8-one is sourced from PubChem (CID 91064588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).