C15H10O5 — CID 59051259
3-methoxy-6-oxobenzo[b][1,4]benzodioxepine-10-carbaldehyde (PubChem CID 59051259) has the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. Its IUPAC name is 3-methoxy-6-oxobenzo[b][1,4]benzodioxepine-10-carbaldehyde.
| Compound Name | 3-methoxy-6-oxobenzo[b][1,4]benzodioxepine-10-carbaldehyde |
|---|---|
| PubChem CID | 59051259 |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 3-methoxy-6-oxobenzo[b][1,4]benzodioxepine-10-carbaldehyde |
| SMILES | COc1ccc2c(c1)OC(=O)c1cccc(C=O)c1O2 |
| InChI | InChI=1S/C15H10O5/c1-18-10-5-6-12-13(7-10)20-15(17)11-4-2-3-9(8-16)14(11)19-12/h2-8H,1H3 |
| InChIKey | PNRNCUSXAWJVNR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|