C9H6O4 — CID 153138791
5-methoxy-1-benzofuran-2,3-dione (PubChem CID 153138791) has the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. Its IUPAC name is 5-methoxy-1-benzofuran-2,3-dione.
| Compound Name | 5-methoxy-1-benzofuran-2,3-dione |
|---|---|
| PubChem CID | 153138791 |
| Molecular Formula | C9H6O4 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 5-methoxy-1-benzofuran-2,3-dione |
| SMILES | COc1ccc2c(c1)C(=O)C(=O)O2 |
| InChI | InChI=1S/C9H6O4/c1-12-5-2-3-7-6(4-5)8(10)9(11)13-7/h2-4H,1H3 |
| InChIKey | VYEZBSHOVFTXCH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|