C18H14O4 — CID 102343711
7,15-dimethoxy-11-oxatetracyclo[11.4.0.02,4.05,10]heptadeca-1(13),2(4),5(10),6,8,14,16-heptaen-3-one (PubChem CID 102343711) has the molecular formula C18H14O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 7,15-dimethoxy-11-oxatetracyclo[11.4.0.02,4.05,10]heptadeca-1(13),2(4),5(10),6,8,14,16-heptaen-3-one.
| Compound Name | 7,15-dimethoxy-11-oxatetracyclo[11.4.0.02,4.05,10]heptadeca-1(13),2(4),5(10),6,8,14,16-heptaen-3-one |
|---|---|
| PubChem CID | 102343711 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 7,15-dimethoxy-11-oxatetracyclo[11.4.0.02,4.05,10]heptadeca-1(13),2(4),5(10),6,8,14,16-heptaen-3-one |
| SMILES | COc1ccc2c(c1)COc1ccc(OC)cc1-c1c-2c1=O |
| InChI | InChI=1S/C18H14O4/c1-20-11-3-5-13-10(7-11)9-22-15-6-4-12(21-2)8-14(15)17-16(13)18(17)19/h3-8H,9H2,1-2H3 |
| InChIKey | FCVLQUHEOFOTJZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |