C13H10BrNO2 — CID 134324079
2-bromo-8-methoxy-6H-isochromeno[3,4-c]pyridine (PubChem CID 134324079) has the molecular formula C13H10BrNO2 and a molecular weight of 292.13 g/mol. Its IUPAC name is 2-bromo-8-methoxy-6H-isochromeno[3,4-c]pyridine.
| Compound Name | 2-bromo-8-methoxy-6H-isochromeno[3,4-c]pyridine |
|---|---|
| PubChem CID | 134324079 |
| Molecular Formula | C13H10BrNO2 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 2-bromo-8-methoxy-6H-isochromeno[3,4-c]pyridine |
| SMILES | COc1ccc2c(c1)COc1cnc(Br)cc1-2 |
| InChI | InChI=1S/C13H10BrNO2/c1-16-9-2-3-10-8(4-9)7-17-12-6-15-13(14)5-11(10)12/h2-6H,7H2,1H3 |
| InChIKey | WZRLJCZSBLHYTK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|