C9H9NO3 — CID 19095507
6-methoxy-3,4-dihydro-1,3-benzoxazin-2-one (PubChem CID 19095507) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is 6-methoxy-3,4-dihydro-1,3-benzoxazin-2-one.
| Compound Name | 6-methoxy-3,4-dihydro-1,3-benzoxazin-2-one |
|---|---|
| PubChem CID | 19095507 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 6-methoxy-3,4-dihydro-1,3-benzoxazin-2-one |
| SMILES | COc1ccc2c(c1)CNC(=O)O2 |
| InChI | InChI=1S/C9H9NO3/c1-12-7-2-3-8-6(4-7)5-10-9(11)13-8/h2-4H,5H2,1H3,(H,10,11) |
| InChIKey | ZOFSQHQZAGDIAR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |