C23H16O5 — CID 170415482
6'-methoxy-3'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-carbaldehyde (PubChem CID 170415482) has the molecular formula C23H16O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is 6'-methoxy-3'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-carbaldehyde.
| Compound Name | 6'-methoxy-3'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-carbaldehyde |
|---|---|
| PubChem CID | 170415482 |
| Molecular Formula | C23H16O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 6'-methoxy-3'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-4'-carbaldehyde |
| SMILES | COc1ccc2c(c1)Oc1c(ccc(C)c1C=O)C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C23H16O5/c1-13-7-9-19-21(16(13)12-24)27-20-11-14(26-2)8-10-18(20)23(19)17-6-4-3-5-15(17)22(25)28-23/h3-12H,1-2H3 |
| InChIKey | GOUOHOZXSOLEMY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|