C22H17O9P — CID 155410904
[4'-(hydroxymethyl)-6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] dihydrogen phosphate (PubChem CID 155410904) has the molecular formula C22H17O9P and a molecular weight of 456.34 g/mol. Its IUPAC name is [4'-(hydroxymethyl)-6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] dihydrogen phosphate.
| Compound Name | [4'-(hydroxymethyl)-6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 155410904 |
| Molecular Formula | C22H17O9P |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | [4'-(hydroxymethyl)-6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] dihydrogen phosphate |
| SMILES | COc1ccc2c(c1)Oc1c(ccc(OP(=O)(O)O)c1CO)C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C22H17O9P/c1-28-12-6-7-16-19(10-12)29-20-14(11-23)18(31-32(25,26)27)9-8-17(20)22(16)15-5-3-2-4-13(15)21(24)30-22/h2-10,23H,11H2,1H3,(H2,25,26,27) |
| InChIKey | FETIOCKDPDDFRZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|