C32H32O13 — CID 68807666
3',6'-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 68807666) has the molecular formula C32H32O13 and a molecular weight of 624.60 g/mol. Its IUPAC name is 3',6'-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 68807666 |
| Molecular Formula | C32H32O13 |
| Molecular Weight | 624.60 g/mol |
| Exact Mass | 624.18 |
| IUPAC Name | 3',6'-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | C[C@H]1O[C@@H](Oc2ccc3c(c2)Oc2cc(O[C@@H]4O[C@H](C)[C@@H](O)[C@H](O)[C@H]4O)ccc2C32OC(=O)c3ccccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C32H32O13/c1-13-23(33)25(35)27(37)30(40-13)42-15-7-9-19-21(11-15)44-22-12-16(43-31-28(38)26(36)24(34)14(2)41-31)8-10-20(22)32(19)18-6-4-3-5-17(18)29(39)45-32/h3-14,23-28,30-31,33-38H,1-2H3/t13-,14-,23-,24-,25+,26+,27-,28-,30+,31+/m1/s1 |
| InChIKey | DIYSCUQCGGXDNW-SJVIMFFCSA-N |
| XLogP | 0.67 |
| TPSA | 193.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.60 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |