C31H38ClNO3 — CID 21154614
1-[3-[4-(7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydrochromen-4-yl)phenoxy]propyl]pyrrolidine;hydrochloride (PubChem CID 21154614) has the molecular formula C31H38ClNO3 and a molecular weight of 508.10 g/mol. Its IUPAC name is 1-[3-[4-(7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydrochromen-4-yl)phenoxy]propyl]pyrrolidine;hydrochloride.
| Compound Name | 1-[3-[4-(7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydrochromen-4-yl)phenoxy]propyl]pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 21154614 |
| Molecular Formula | C31H38ClNO3 |
| Molecular Weight | 508.10 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 1-[3-[4-(7-methoxy-2,2-dimethyl-3-phenyl-3,4-dihydrochromen-4-yl)phenoxy]propyl]pyrrolidine;hydrochloride |
| SMILES | COc1ccc2c(c1)OC(C)(C)C(c1ccccc1)C2c1ccc(OCCCN2CCCC2)cc1.Cl |
| InChI | InChI=1S/C31H37NO3.ClH/c1-31(2)30(24-10-5-4-6-11-24)29(27-17-16-26(33-3)22-28(27)35-31)23-12-14-25(15-13-23)34-21-9-20-32-18-7-8-19-32;/h4-6,10-17,22,29-30H,7-9,18-21H2,1-3H3;1H |
| InChIKey | RBHWZHMCECUJHR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.10 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|