C14H15IO4 — CID 11485611
(3aR,9bS)-3a-iodo-7-methoxy-4,4-dimethyl-3,9b-dihydrofuro[3,2-c]chromen-2-one (PubChem CID 11485611) has the molecular formula C14H15IO4 and a molecular weight of 374.17 g/mol. Its IUPAC name is (3aR,9bS)-3a-iodo-7-methoxy-4,4-dimethyl-3,9b-dihydrofuro[3,2-c]chromen-2-one.
| Compound Name | (3aR,9bS)-3a-iodo-7-methoxy-4,4-dimethyl-3,9b-dihydrofuro[3,2-c]chromen-2-one |
|---|---|
| PubChem CID | 11485611 |
| Molecular Formula | C14H15IO4 |
| Molecular Weight | 374.17 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | (3aR,9bS)-3a-iodo-7-methoxy-4,4-dimethyl-3,9b-dihydrofuro[3,2-c]chromen-2-one |
| SMILES | COc1ccc2c(c1)OC(C)(C)[C@@]1(I)CC(=O)O[C@@H]21 |
| InChI | InChI=1S/C14H15IO4/c1-13(2)14(15)7-11(16)18-12(14)9-5-4-8(17-3)6-10(9)19-13/h4-6,12H,7H2,1-3H3/t12-,14+/m0/s1 |
| InChIKey | XILDCCHKEPUDLM-GXTWGEPZSA-N |
| XLogP | 3.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|