C13H10F6O4S — CID 174600169
[2,2-dimethyl-4-(trifluoromethyl)chromen-7-yl] trifluoromethanesulfonate (PubChem CID 174600169) has the molecular formula C13H10F6O4S and a molecular weight of 376.27 g/mol. Its IUPAC name is [2,2-dimethyl-4-(trifluoromethyl)chromen-7-yl] trifluoromethanesulfonate.
| Compound Name | [2,2-dimethyl-4-(trifluoromethyl)chromen-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 174600169 |
| Molecular Formula | C13H10F6O4S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | [2,2-dimethyl-4-(trifluoromethyl)chromen-7-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)C=C(C(F)(F)F)c2ccc(OS(=O)(=O)C(F)(F)F)cc2O1 |
| InChI | InChI=1S/C13H10F6O4S/c1-11(2)6-9(12(14,15)16)8-4-3-7(5-10(8)22-11)23-24(20,21)13(17,18)19/h3-6H,1-2H3 |
| InChIKey | FOIPAIBRXXXOAO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|