C18H15F3O6S — CID 139602273
[3,3-dimethyl-5-(trifluoromethylsulfonyloxy)-2H-1-benzofuran-2-yl] benzoate (PubChem CID 139602273) has the molecular formula C18H15F3O6S and a molecular weight of 416.37 g/mol. Its IUPAC name is [3,3-dimethyl-5-(trifluoromethylsulfonyloxy)-2H-1-benzofuran-2-yl] benzoate.
| Compound Name | [3,3-dimethyl-5-(trifluoromethylsulfonyloxy)-2H-1-benzofuran-2-yl] benzoate |
|---|---|
| PubChem CID | 139602273 |
| Molecular Formula | C18H15F3O6S |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | [3,3-dimethyl-5-(trifluoromethylsulfonyloxy)-2H-1-benzofuran-2-yl] benzoate |
| SMILES | CC1(C)c2cc(OS(=O)(=O)C(F)(F)F)ccc2OC1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15F3O6S/c1-17(2)13-10-12(27-28(23,24)18(19,20)21)8-9-14(13)25-16(17)26-15(22)11-6-4-3-5-7-11/h3-10,16H,1-2H3 |
| InChIKey | KNVWGNOXKZHSLU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|