C23H20F3NO6S — CID 88880950
[(1R,9R,13S)-10-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate (PubChem CID 88880950) has the molecular formula C23H20F3NO6S and a molecular weight of 495.48 g/mol. Its IUPAC name is [(1R,9R,13S)-10-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate.
| Compound Name | [(1R,9R,13S)-10-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88880950 |
| Molecular Formula | C23H20F3NO6S |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | [(1R,9R,13S)-10-[(3R)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
| SMILES | C[C@@]12CC3[C@H]1[C@@H](Cc1ccc(OS(=O)(=O)C(F)(F)F)cc12)N3C(=O)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C23H20F3NO6S/c1-22-10-16-20(22)15(27(16)21(28)19-11-31-17-4-2-3-5-18(17)32-19)8-12-6-7-13(9-14(12)22)33-34(29,30)23(24,25)26/h2-7,9,15-16,19-20H,8,10-11H2,1H3/t15-,16?,19-,20-,22+/m1/s1 |
| InChIKey | WCVABYLOSIPGCU-MMRHEVKVSA-N |
| XLogP | 3.17 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|