C23H25NO3 — CID 123170030
[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-(1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl)methanone (PubChem CID 123170030) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is [(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-(1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl)methanone.
| Compound Name | [(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-(1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl)methanone |
|---|---|
| PubChem CID | 123170030 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]-(1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl)methanone |
| SMILES | CC1C2Cc3ccccc3C1(C)CCN2C(=O)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C23H25NO3/c1-15-18-13-16-7-3-4-8-17(16)23(15,2)11-12-24(18)22(25)21-14-26-19-9-5-6-10-20(19)27-21/h3-10,15,18,21H,11-14H2,1-2H3/t15?,18?,21-,23?/m1/s1 |
| InChIKey | VHXMRQPEDURYLP-KMLQZWLPSA-N |
| XLogP | 3.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |